C22H25N5O3S — CID 112834593
N-(2,4-dimorpholin-4-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 112834593) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 112834593 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1N1CCOCC1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C22H25N5O3S/c28-22(19-15-18(24-25-19)21-2-1-13-31-21)23-17-4-3-16(26-5-9-29-10-6-26)14-20(17)27-7-11-30-12-8-27/h1-4,13-15H,5-12H2,(H,23,28)(H,24,25) |
| InChIKey | ICUAKANNNQAAMM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |