C18H17N3O3S — CID 18136368
N-(4-morpholin-4-ylphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 18136368) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 18136368 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C18H17N3O3S/c22-18(15-12-16(24-20-15)17-2-1-11-25-17)19-13-3-5-14(6-4-13)21-7-9-23-10-8-21/h1-6,11-12H,7-10H2,(H,19,22) |
| InChIKey | GJPQWWBRHBXVGJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|