C12H12N2O3S — CID 3242386
morpholin-4-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone (PubChem CID 3242386) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is morpholin-4-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone.
| Compound Name | morpholin-4-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 3242386 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | morpholin-4-yl-(5-thiophen-2-yl-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(c1cc(-c2cccs2)on1)N1CCOCC1 |
| InChI | InChI=1S/C12H12N2O3S/c15-12(14-3-5-16-6-4-14)9-8-10(17-13-9)11-2-1-7-18-11/h1-2,7-8H,3-6H2 |
| InChIKey | PGCWRGGPXZFLAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |