C20H21N5O3S — CID 55791101
N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55791101) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55791101 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(NC(=O)c2cc(-c3cccs3)[nH]n2)cc1 |
| InChI | InChI=1S/C20H21N5O3S/c26-19(13-25-7-9-28-10-8-25)21-14-3-5-15(6-4-14)22-20(27)17-12-16(23-24-17)18-2-1-11-29-18/h1-6,11-12H,7-10,13H2,(H,21,26)(H,22,27)(H,23,24) |
| InChIKey | LASDHPHTDSCMPN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |