C15H11F2N3OS2 — CID 55746673
N-[4-(difluoromethylsulfanyl)phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55746673) has the molecular formula C15H11F2N3OS2 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55746673 |
| Molecular Formula | C15H11F2N3OS2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C15H11F2N3OS2/c16-15(17)23-10-5-3-9(4-6-10)18-14(21)12-8-11(19-20-12)13-2-1-7-22-13/h1-8,15H,(H,18,21)(H,19,20) |
| InChIKey | KSKKCDOWFOVATQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |