C15H10N4OS2 — CID 55792015
N-(1,3-benzothiazol-2-yl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55792015) has the molecular formula C15H10N4OS2 and a molecular weight of 326.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55792015 |
| Molecular Formula | C15H10N4OS2 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C15H10N4OS2/c20-14(11-8-10(18-19-11)12-6-3-7-21-12)17-15-16-9-4-1-2-5-13(9)22-15/h1-8H,(H,18,19)(H,16,17,20) |
| InChIKey | YOOIBQBEHXRJDA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |