C17H13N5OS — CID 55930525
N-(2-pyrazol-1-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55930525) has the molecular formula C17H13N5OS and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(2-pyrazol-1-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-pyrazol-1-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55930525 |
| Molecular Formula | C17H13N5OS |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-(2-pyrazol-1-ylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-n1cccn1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C17H13N5OS/c23-17(14-11-13(20-21-14)16-7-3-10-24-16)19-12-5-1-2-6-15(12)22-9-4-8-18-22/h1-11H,(H,19,23)(H,20,21) |
| InChIKey | UHNJFUCDNIVGTM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |