C15H12FN3OS — CID 55741810
N-(4-fluoro-2-methylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 55741810) has the molecular formula C15H12FN3OS and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(4-fluoro-2-methylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55741810 |
| Molecular Formula | C15H12FN3OS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C15H12FN3OS/c1-9-7-10(16)4-5-11(9)17-15(20)13-8-12(18-19-13)14-3-2-6-21-14/h2-8H,1H3,(H,17,20)(H,18,19) |
| InChIKey | HXEVIWHKHANGJK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |