C15H9N3OS2 — CID 86264452
N-(1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide (PubChem CID 86264452) has the molecular formula C15H9N3OS2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 86264452 |
| Molecular Formula | C15H9N3OS2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H9N3OS2/c19-13(14-16-9-5-1-3-7-11(9)20-14)18-15-17-10-6-2-4-8-12(10)21-15/h1-8H,(H,17,18,19) |
| InChIKey | QRWVXFMPSLPFDR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |