C15H8BrN3OS2 — CID 7189855
N-(4-bromo-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide (PubChem CID 7189855) has the molecular formula C15H8BrN3OS2 and a molecular weight of 390.29 g/mol. Its IUPAC name is N-(4-bromo-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(4-bromo-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 7189855 |
| Molecular Formula | C15H8BrN3OS2 |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | N-(4-bromo-1,3-benzothiazol-2-yl)-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1nc2c(Br)cccc2s1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H8BrN3OS2/c16-8-4-3-7-11-12(8)18-15(22-11)19-13(20)14-17-9-5-1-2-6-10(9)21-14/h1-7H,(H,18,19,20) |
| InChIKey | MXJAKZSUZXWYLX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |