C14H9FN2OS — CID 5124389
N-(2-fluorophenyl)-1,3-benzothiazole-2-carboxamide (PubChem CID 5124389) has the molecular formula C14H9FN2OS and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(2-fluorophenyl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(2-fluorophenyl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 5124389 |
| Molecular Formula | C14H9FN2OS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | N-(2-fluorophenyl)-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H9FN2OS/c15-9-5-1-2-6-10(9)16-13(18)14-17-11-7-3-4-8-12(11)19-14/h1-8H,(H,16,18) |
| InChIKey | ODPNTOROVRBRQN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |