C23H18N2O3S — CID 67342631
2-(1,3-benzothiazole-2-carbonylamino)-4-(2-phenylethyl)benzoic acid (PubChem CID 67342631) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-(1,3-benzothiazole-2-carbonylamino)-4-(2-phenylethyl)benzoic acid.
| Compound Name | 2-(1,3-benzothiazole-2-carbonylamino)-4-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 67342631 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(1,3-benzothiazole-2-carbonylamino)-4-(2-phenylethyl)benzoic acid |
| SMILES | O=C(Nc1cc(CCc2ccccc2)ccc1C(=O)O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H18N2O3S/c26-21(22-25-18-8-4-5-9-20(18)29-22)24-19-14-16(12-13-17(19)23(27)28)11-10-15-6-2-1-3-7-15/h1-9,12-14H,10-11H2,(H,24,26)(H,27,28) |
| InChIKey | NMOAOLUOTSQHIE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |