C22H18ClNO3 — CID 67344362
2-[(2-chlorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid (PubChem CID 67344362) has the molecular formula C22H18ClNO3 and a molecular weight of 379.84 g/mol. Its IUPAC name is 2-[(2-chlorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid.
| Compound Name | 2-[(2-chlorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 67344362 |
| Molecular Formula | C22H18ClNO3 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[(2-chlorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid |
| SMILES | O=C(Nc1cc(CCc2ccccc2)ccc1C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C22H18ClNO3/c23-19-9-5-4-8-17(19)21(25)24-20-14-16(12-13-18(20)22(26)27)11-10-15-6-2-1-3-7-15/h1-9,12-14H,10-11H2,(H,24,25)(H,26,27) |
| InChIKey | GORJPLUHQLUQNH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |