C22H18FNO3 — CID 67344319
2-[(3-fluorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid (PubChem CID 67344319) has the molecular formula C22H18FNO3 and a molecular weight of 363.39 g/mol. Its IUPAC name is 2-[(3-fluorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid.
| Compound Name | 2-[(3-fluorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 67344319 |
| Molecular Formula | C22H18FNO3 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[(3-fluorobenzoyl)amino]-4-(2-phenylethyl)benzoic acid |
| SMILES | O=C(Nc1cc(CCc2ccccc2)ccc1C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H18FNO3/c23-18-8-4-7-17(14-18)21(25)24-20-13-16(11-12-19(20)22(26)27)10-9-15-5-2-1-3-6-15/h1-8,11-14H,9-10H2,(H,24,25)(H,26,27) |
| InChIKey | YWRWYZXUOXZTLH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |