C20H17NO3S — CID 67344551
4-(2-phenylethyl)-2-(thiophene-2-carbonylamino)benzoic acid (PubChem CID 67344551) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-(2-phenylethyl)-2-(thiophene-2-carbonylamino)benzoic acid.
| Compound Name | 4-(2-phenylethyl)-2-(thiophene-2-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 67344551 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-(2-phenylethyl)-2-(thiophene-2-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1cc(CCc2ccccc2)ccc1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C20H17NO3S/c22-19(18-7-4-12-25-18)21-17-13-15(10-11-16(17)20(23)24)9-8-14-5-2-1-3-6-14/h1-7,10-13H,8-9H2,(H,21,22)(H,23,24) |
| InChIKey | BJPAKWHHUVQQFZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |