C23H21NO4 — CID 67342372
2-[(2-phenoxyacetyl)amino]-4-(2-phenylethyl)benzoic acid (PubChem CID 67342372) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is 2-[(2-phenoxyacetyl)amino]-4-(2-phenylethyl)benzoic acid.
| Compound Name | 2-[(2-phenoxyacetyl)amino]-4-(2-phenylethyl)benzoic acid |
|---|---|
| PubChem CID | 67342372 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 2-[(2-phenoxyacetyl)amino]-4-(2-phenylethyl)benzoic acid |
| SMILES | O=C(COc1ccccc1)Nc1cc(CCc2ccccc2)ccc1C(=O)O |
| InChI | InChI=1S/C23H21NO4/c25-22(16-28-19-9-5-2-6-10-19)24-21-15-18(13-14-20(21)23(26)27)12-11-17-7-3-1-4-8-17/h1-10,13-15H,11-12,16H2,(H,24,25)(H,26,27) |
| InChIKey | KODDYGKMKHXHRM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |