C15H11ClFNO4 — CID 2194379
4-chloro-2-[[2-(4-fluorophenoxy)acetyl]amino]benzoic acid (PubChem CID 2194379) has the molecular formula C15H11ClFNO4 and a molecular weight of 323.71 g/mol. Its IUPAC name is 4-chloro-2-[[2-(4-fluorophenoxy)acetyl]amino]benzoic acid.
| Compound Name | 4-chloro-2-[[2-(4-fluorophenoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2194379 |
| Molecular Formula | C15H11ClFNO4 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 4-chloro-2-[[2-(4-fluorophenoxy)acetyl]amino]benzoic acid |
| SMILES | O=C(COc1ccc(F)cc1)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C15H11ClFNO4/c16-9-1-6-12(15(20)21)13(7-9)18-14(19)8-22-11-4-2-10(17)3-5-11/h1-7H,8H2,(H,18,19)(H,20,21) |
| InChIKey | PXJYRTOSCWMNKV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |