C15H11Cl2NO4 — CID 11302225
2-[[2-(3,5-dichlorophenoxy)acetyl]amino]benzoic acid (PubChem CID 11302225) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is 2-[[2-(3,5-dichlorophenoxy)acetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(3,5-dichlorophenoxy)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11302225 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-[[2-(3,5-dichlorophenoxy)acetyl]amino]benzoic acid |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H11Cl2NO4/c16-9-5-10(17)7-11(6-9)22-8-14(19)18-13-4-2-1-3-12(13)15(20)21/h1-7H,8H2,(H,18,19)(H,20,21) |
| InChIKey | MEQRQIDRMCQBNO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |