5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid

C17H16ClNO4 — CID 2233863

IUPAC5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid
SMILESCc1cc(C)cc(OCC(=O)Nc2ccc(Cl)cc2C(=O)O)c1
InChIInChI=1S/C17H16ClNO4/c1-10-5-11(2)7-13(6-10)23-9-16(20)19-15-4-3-12(18)8-14(15)17(21)22/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22)
InChIKeyBIUKFYYMNLKLGP-UHFFFAOYSA-N
MW333.77 g/mol
LogP3.67
Rot. Bonds5

About 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid

5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid (PubChem CID 2233863) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid.

Molecular Properties

Compound Name5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid
PubChem CID2233863
Molecular FormulaC17H16ClNO4
Molecular Weight333.77 g/mol
Exact Mass333.08
IUPAC Name5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid
SMILESCc1cc(C)cc(OCC(=O)Nc2ccc(Cl)cc2C(=O)O)c1
InChIInChI=1S/C17H16ClNO4/c1-10-5-11(2)7-13(6-10)23-9-16(20)19-15-4-3-12(18)8-14(15)17(21)22/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22)
InChIKeyBIUKFYYMNLKLGP-UHFFFAOYSA-N
XLogP3.67
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500333.77
LogP ≤ 53.67
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid?
The IUPAC name of 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid (CID 2233863) is 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid.
What is the SMILES notation for 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid?
The canonical SMILES for 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid is Cc1cc(C)cc(OCC(=O)Nc2ccc(Cl)cc2C(=O)O)c1.
What is the InChIKey of 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid?
The InChIKey is BIUKFYYMNLKLGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClNO4/c1-10-5-11(2)7-13(6-10)23-9-16(20)19-15-4-3-12(18)8-14(15)17(21)22/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid?
5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid has a molecular weight of 333.77 g/mol, XLogP of 3.67, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-[[2-(3,5-dimethylphenoxy)acetyl]amino]benzoic acid is sourced from PubChem (CID 2233863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).