C25H26ClNO4 — CID 66679797
2-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoic acid (PubChem CID 66679797) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is 2-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoic acid.
| Compound Name | 2-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoic acid |
|---|---|
| PubChem CID | 66679797 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-[[2-[4-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoic acid |
| SMILES | O=C(COc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)Nc1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C25H26ClNO4/c26-19-3-6-22(21(10-19)24(29)30)27-23(28)14-31-20-4-1-18(2-5-20)25-11-15-7-16(12-25)9-17(8-15)13-25/h1-6,10,15-17H,7-9,11-14H2,(H,27,28)(H,29,30) |
| InChIKey | OKGVKWJHOXBOFC-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |