C26H28ClNO4 — CID 66679857
methyl 2-[[2-[3-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoate (PubChem CID 66679857) has the molecular formula C26H28ClNO4 and a molecular weight of 453.97 g/mol. Its IUPAC name is methyl 2-[[2-[3-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoate.
| Compound Name | methyl 2-[[2-[3-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoate |
|---|---|
| PubChem CID | 66679857 |
| Molecular Formula | C26H28ClNO4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | methyl 2-[[2-[3-(1-adamantyl)phenoxy]acetyl]amino]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)COc1cccc(C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C26H28ClNO4/c1-31-25(30)22-11-20(27)5-6-23(22)28-24(29)15-32-21-4-2-3-19(10-21)26-12-16-7-17(13-26)9-18(8-16)14-26/h2-6,10-11,16-18H,7-9,12-15H2,1H3,(H,28,29) |
| InChIKey | NNXGWVSBCHKWGG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |