C14H9ClF3NO2 — CID 2633081
2-(3-chlorophenoxy)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2633081) has the molecular formula C14H9ClF3NO2 and a molecular weight of 315.68 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2633081 |
| Molecular Formula | C14H9ClF3NO2 |
| Molecular Weight | 315.68 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H9ClF3NO2/c15-8-2-1-3-9(6-8)21-7-12(20)19-11-5-4-10(16)13(17)14(11)18/h1-6H,7H2,(H,19,20) |
| InChIKey | FFODCMFQFBOUOH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|