C15H10ClF3N2O3 — CID 7893862
5-chloro-2-[2-oxo-2-(2,3,4-trifluoroanilino)ethoxy]benzamide (PubChem CID 7893862) has the molecular formula C15H10ClF3N2O3 and a molecular weight of 358.70 g/mol. Its IUPAC name is 5-chloro-2-[2-oxo-2-(2,3,4-trifluoroanilino)ethoxy]benzamide.
| Compound Name | 5-chloro-2-[2-oxo-2-(2,3,4-trifluoroanilino)ethoxy]benzamide |
|---|---|
| PubChem CID | 7893862 |
| Molecular Formula | C15H10ClF3N2O3 |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 5-chloro-2-[2-oxo-2-(2,3,4-trifluoroanilino)ethoxy]benzamide |
| SMILES | NC(=O)c1cc(Cl)ccc1OCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H10ClF3N2O3/c16-7-1-4-11(8(5-7)15(20)23)24-6-12(22)21-10-3-2-9(17)13(18)14(10)19/h1-5H,6H2,(H2,20,23)(H,21,22) |
| InChIKey | GSSOGRMFLOMUQA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|