C27H26ClNO3 — CID 66679970
methyl 2-[3-[4-(1-adamantyl)phenyl]prop-2-ynoylamino]-5-chlorobenzoate (PubChem CID 66679970) has the molecular formula C27H26ClNO3 and a molecular weight of 447.96 g/mol. Its IUPAC name is methyl 2-[3-[4-(1-adamantyl)phenyl]prop-2-ynoylamino]-5-chlorobenzoate.
| Compound Name | methyl 2-[3-[4-(1-adamantyl)phenyl]prop-2-ynoylamino]-5-chlorobenzoate |
|---|---|
| PubChem CID | 66679970 |
| Molecular Formula | C27H26ClNO3 |
| Molecular Weight | 447.96 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | methyl 2-[3-[4-(1-adamantyl)phenyl]prop-2-ynoylamino]-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1NC(=O)C#Cc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H26ClNO3/c1-32-26(31)23-13-22(28)7-8-24(23)29-25(30)9-4-17-2-5-21(6-3-17)27-14-18-10-19(15-27)12-20(11-18)16-27/h2-3,5-8,13,18-20H,10-12,14-16H2,1H3,(H,29,30) |
| InChIKey | RXXIDTFMICKKEW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|