C23H23Cl2NO — CID 4545545
N-[4-(1-adamantyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 4545545) has the molecular formula C23H23Cl2NO and a molecular weight of 400.35 g/mol. Its IUPAC name is N-[4-(1-adamantyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-(1-adamantyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4545545 |
| Molecular Formula | C23H23Cl2NO |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[4-(1-adamantyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H23Cl2NO/c24-18-3-6-20(21(25)10-18)22(27)26-19-4-1-17(2-5-19)23-11-14-7-15(12-23)9-16(8-14)13-23/h1-6,10,14-16H,7-9,11-13H2,(H,26,27) |
| InChIKey | KQYMTSQIZVOQLD-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |