About N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide
N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide (PubChem CID 4032449) has the molecular formula C25H26Cl2N2O2
and a molecular weight of 457.40 g/mol. Its IUPAC name is N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide |
| PubChem CID | 4032449 |
| Molecular Formula | C25H26Cl2N2O2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O2/c26-18-1-6-21(22(27)10-18)24(31)29-20-4-2-19(3-5-20)28-23(30)14-25-11-15-7-16(12-25)9-17(8-15)13-25/h1-6,10,15-17H,7-9,11-14H2,(H,28,30)(H,29,31) |
| InChIKey | JWRMFKWMQQXZHT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide?
The IUPAC name of N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide (CID 4032449) is N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide.
What is the SMILES notation for N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide?
The canonical SMILES for N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide is O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1.
What is the InChIKey of N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide?
The InChIKey is JWRMFKWMQQXZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26Cl2N2O2/c26-18-1-6-21(22(27)10-18)24(31)29-20-4-2-19(3-5-20)28-23(30)14-25-11-15-7-16(12-25)9-17(8-15)13-25/h1-6,10,15-17H,7-9,11-14H2,(H,28,30)(H,29,31).
What are the key properties of N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide?
N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide has a molecular weight of 457.40 g/mol, XLogP of 6.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide is sourced from PubChem (CID 4032449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).