C25H26Cl2N2O2 — CID 4032449
N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide (PubChem CID 4032449) has the molecular formula C25H26Cl2N2O2 and a molecular weight of 457.40 g/mol. Its IUPAC name is N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4032449 |
| Molecular Formula | C25H26Cl2N2O2 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[4-[[2-(1-adamantyl)acetyl]amino]phenyl]-2,4-dichlorobenzamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)Nc1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H26Cl2N2O2/c26-18-1-6-21(22(27)10-18)24(31)29-20-4-2-19(3-5-20)28-23(30)14-25-11-15-7-16(12-25)9-17(8-15)13-25/h1-6,10,15-17H,7-9,11-14H2,(H,28,30)(H,29,31) |
| InChIKey | JWRMFKWMQQXZHT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |