C16H13Cl2NOS2 — CID 2819049
2,4-dichloro-N-[4-(1,3-dithiolan-2-yl)phenyl]benzamide (PubChem CID 2819049) has the molecular formula C16H13Cl2NOS2 and a molecular weight of 370.33 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(1,3-dithiolan-2-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(1,3-dithiolan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 2819049 |
| Molecular Formula | C16H13Cl2NOS2 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 2,4-dichloro-N-[4-(1,3-dithiolan-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2SCCS2)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NOS2/c17-11-3-6-13(14(18)9-11)15(20)19-12-4-1-10(2-5-12)16-21-7-8-22-16/h1-6,9,16H,7-8H2,(H,19,20) |
| InChIKey | BBSPVUCRSVIYAU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |