C20H12Cl4N2O4S — CID 5064055
2,4-dichloro-N-[4-[(2,4-dichlorobenzoyl)sulfamoyl]phenyl]benzamide (PubChem CID 5064055) has the molecular formula C20H12Cl4N2O4S and a molecular weight of 518.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[(2,4-dichlorobenzoyl)sulfamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[(2,4-dichlorobenzoyl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 5064055 |
| Molecular Formula | C20H12Cl4N2O4S |
| Molecular Weight | 518.21 g/mol |
| Exact Mass | 515.93 |
| IUPAC Name | 2,4-dichloro-N-[4-[(2,4-dichlorobenzoyl)sulfamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H12Cl4N2O4S/c21-11-1-7-15(17(23)9-11)19(27)25-13-3-5-14(6-4-13)31(29,30)26-20(28)16-8-2-12(22)10-18(16)24/h1-10H,(H,25,27)(H,26,28) |
| InChIKey | MAAKXRYWTFKSCA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.21 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |