C18H18Cl2N2O5S — CID 69206535
(2S)-2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]sulfonylamino]-3-methylbutanoic acid (PubChem CID 69206535) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is (2S)-2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]sulfonylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 69206535 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | (2S)-2-[[4-[(2,4-dichlorobenzoyl)amino]phenyl]sulfonylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-10(2)16(18(24)25)22-28(26,27)13-6-4-12(5-7-13)21-17(23)14-8-3-11(19)9-15(14)20/h3-10,16,22H,1-2H3,(H,21,23)(H,24,25)/t16-/m0/s1 |
| InChIKey | NHGAOMWJKAASMG-INIZCTEOSA-N |
| XLogP | 3.63 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |