C14H11Cl2NO3S2 — CID 11474329
2,4-dichloro-N-(4-methylsulfanylphenyl)sulfonylbenzamide (PubChem CID 11474329) has the molecular formula C14H11Cl2NO3S2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 2,4-dichloro-N-(4-methylsulfanylphenyl)sulfonylbenzamide.
| Compound Name | 2,4-dichloro-N-(4-methylsulfanylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 11474329 |
| Molecular Formula | C14H11Cl2NO3S2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 2,4-dichloro-N-(4-methylsulfanylphenyl)sulfonylbenzamide |
| SMILES | CSc1ccc(S(=O)(=O)NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2NO3S2/c1-21-10-3-5-11(6-4-10)22(19,20)17-14(18)12-7-2-9(15)8-13(12)16/h2-8H,1H3,(H,17,18) |
| InChIKey | WDZVJGNTRLDPPZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |