C15H14ClNO5S — CID 11279720
N-(4-chlorophenyl)sulfonyl-2,4-dimethoxybenzamide (PubChem CID 11279720) has the molecular formula C15H14ClNO5S and a molecular weight of 355.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfonyl-2,4-dimethoxybenzamide.
| Compound Name | N-(4-chlorophenyl)sulfonyl-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 11279720 |
| Molecular Formula | C15H14ClNO5S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-(4-chlorophenyl)sulfonyl-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NS(=O)(=O)c2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C15H14ClNO5S/c1-21-11-5-8-13(14(9-11)22-2)15(18)17-23(19,20)12-6-3-10(16)4-7-12/h3-9H,1-2H3,(H,17,18) |
| InChIKey | XMMNALAEFPAOOT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |