C17H19ClN2O5S — CID 7318747
(2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)propanamide (PubChem CID 7318747) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)propanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 7318747 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonylamino]-N-(2,5-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H](C)NS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H19ClN2O5S/c1-11(20-26(22,23)14-7-4-12(18)5-8-14)17(21)19-15-10-13(24-2)6-9-16(15)25-3/h4-11,20H,1-3H3,(H,19,21)/t11-/m1/s1 |
| InChIKey | VYORCSOEYKKREW-LLVKDONJSA-N |
| XLogP | 2.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |