C22H29N3O6S — CID 39471769
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(2-butoxy-5-methoxyphenyl)propanamide (PubChem CID 39471769) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(2-butoxy-5-methoxyphenyl)propanamide.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(2-butoxy-5-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 39471769 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-N-(2-butoxy-5-methoxyphenyl)propanamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)[C@H](C)NS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C22H29N3O6S/c1-5-6-13-31-21-12-9-18(30-4)14-20(21)24-22(27)15(2)25-32(28,29)19-10-7-17(8-11-19)23-16(3)26/h7-12,14-15,25H,5-6,13H2,1-4H3,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | UTFLXEAJNLHKAT-HNNXBMFYSA-N |
| XLogP | 3.14 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|