C20H24FNO4 — CID 46437000
N-(2-butoxy-5-methoxyphenyl)-2-(4-fluorophenoxy)propanamide (PubChem CID 46437000) has the molecular formula C20H24FNO4 and a molecular weight of 361.41 g/mol. Its IUPAC name is N-(2-butoxy-5-methoxyphenyl)-2-(4-fluorophenoxy)propanamide.
| Compound Name | N-(2-butoxy-5-methoxyphenyl)-2-(4-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 46437000 |
| Molecular Formula | C20H24FNO4 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-(2-butoxy-5-methoxyphenyl)-2-(4-fluorophenoxy)propanamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)C(C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FNO4/c1-4-5-12-25-19-11-10-17(24-3)13-18(19)22-20(23)14(2)26-16-8-6-15(21)7-9-16/h6-11,13-14H,4-5,12H2,1-3H3,(H,22,23) |
| InChIKey | OQWDSPMGOFXSEU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|