C24H32N2O5 — CID 55675298
N-[1-(2-butoxy-5-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 55675298) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-[1-(2-butoxy-5-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[1-(2-butoxy-5-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 55675298 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-[1-(2-butoxy-5-methoxyanilino)-3-methyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)C(NC(=O)c1ccc(OC)cc1)C(C)C |
| InChI | InChI=1S/C24H32N2O5/c1-6-7-14-31-21-13-12-19(30-5)15-20(21)25-24(28)22(16(2)3)26-23(27)17-8-10-18(29-4)11-9-17/h8-13,15-16,22H,6-7,14H2,1-5H3,(H,25,28)(H,26,27) |
| InChIKey | YBITWXYVYUMFMP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|