C19H25ClN2O3 — CID 119284799
4-(aminomethyl)-N-(2-butoxy-5-methoxyphenyl)benzamide;hydrochloride (PubChem CID 119284799) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-butoxy-5-methoxyphenyl)benzamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-(2-butoxy-5-methoxyphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119284799 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-(aminomethyl)-N-(2-butoxy-5-methoxyphenyl)benzamide;hydrochloride |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)c1ccc(CN)cc1.Cl |
| InChI | InChI=1S/C19H24N2O3.ClH/c1-3-4-11-24-18-10-9-16(23-2)12-17(18)21-19(22)15-7-5-14(13-20)6-8-15;/h5-10,12H,3-4,11,13,20H2,1-2H3,(H,21,22);1H |
| InChIKey | GTXOHDHKAFSCFZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|