C23H30N2O5 — CID 35363555
tert-butyl N-[4-[(2-butoxy-5-methoxyphenyl)carbamoyl]phenyl]carbamate (PubChem CID 35363555) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-butoxy-5-methoxyphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-butoxy-5-methoxyphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 35363555 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | tert-butyl N-[4-[(2-butoxy-5-methoxyphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-6-7-14-29-20-13-12-18(28-5)15-19(20)25-21(26)16-8-10-17(11-9-16)24-22(27)30-23(2,3)4/h8-13,15H,6-7,14H2,1-5H3,(H,24,27)(H,25,26) |
| InChIKey | BSCCSQQAVKDKEG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|