C18H30N2O3 — CID 107239632
tert-butyl N-[5-(hexylamino)-2-methoxyphenyl]carbamate (PubChem CID 107239632) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl N-[5-(hexylamino)-2-methoxyphenyl]carbamate.
| Compound Name | tert-butyl N-[5-(hexylamino)-2-methoxyphenyl]carbamate |
|---|---|
| PubChem CID | 107239632 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | tert-butyl N-[5-(hexylamino)-2-methoxyphenyl]carbamate |
| SMILES | CCCCCCNc1ccc(OC)c(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H30N2O3/c1-6-7-8-9-12-19-14-10-11-16(22-5)15(13-14)20-17(21)23-18(2,3)4/h10-11,13,19H,6-9,12H2,1-5H3,(H,20,21) |
| InChIKey | NQQIDDHCVKYCPM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|