C26H18Cl3N3O8S2 — CID 11239298
2-chloro-N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide;N-(4-chlorophenyl)sulfonylbenzamide (PubChem CID 11239298) has the molecular formula C26H18Cl3N3O8S2 and a molecular weight of 670.94 g/mol. Its IUPAC name is 2-chloro-N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide;N-(4-chlorophenyl)sulfonylbenzamide.
| Compound Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide;N-(4-chlorophenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 11239298 |
| Molecular Formula | C26H18Cl3N3O8S2 |
| Molecular Weight | 670.94 g/mol |
| Exact Mass | 668.96 |
| IUPAC Name | 2-chloro-N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide;N-(4-chlorophenyl)sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1Cl.O=C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C13H8Cl2N2O5S.C13H10ClNO3S/c14-8-1-4-10(5-2-8)23(21,22)16-13(18)11-6-3-9(17(19)20)7-12(11)15;14-11-6-8-12(9-7-11)19(17,18)15-13(16)10-4-2-1-3-5-10/h1-7H,(H,16,18);1-9H,(H,15,16) |
| InChIKey | NDRNILFBXBFZLQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 169.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.94 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|