C14H9Cl2N3O4 — CID 3591876
2,4-dichloro-N'-(4-nitrobenzoyl)benzohydrazide (PubChem CID 3591876) has the molecular formula C14H9Cl2N3O4 and a molecular weight of 354.15 g/mol. Its IUPAC name is 2,4-dichloro-N'-(4-nitrobenzoyl)benzohydrazide.
| Compound Name | 2,4-dichloro-N'-(4-nitrobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 3591876 |
| Molecular Formula | C14H9Cl2N3O4 |
| Molecular Weight | 354.15 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2,4-dichloro-N'-(4-nitrobenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9Cl2N3O4/c15-9-3-6-11(12(16)7-9)14(21)18-17-13(20)8-1-4-10(5-2-8)19(22)23/h1-7H,(H,17,20)(H,18,21) |
| InChIKey | RREJBNQQNDQZTH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|