C21H15ClN4O5 — CID 126001785
4-chloro-N-[2-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 126001785) has the molecular formula C21H15ClN4O5 and a molecular weight of 438.83 g/mol. Its IUPAC name is 4-chloro-N-[2-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126001785 |
| Molecular Formula | C21H15ClN4O5 |
| Molecular Weight | 438.83 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-chloro-N-[2-[[(4-nitrobenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(NNC(=O)c1ccccc1NC(=O)c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H15ClN4O5/c22-15-9-5-13(6-10-15)19(27)23-18-4-2-1-3-17(18)21(29)25-24-20(28)14-7-11-16(12-8-14)26(30)31/h1-12H,(H,23,27)(H,24,28)(H,25,29) |
| InChIKey | AGWXYHMKQWELEK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.83 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|