C20H20N3O6- — CID 7220956
(2R)-4-methyl-2-[[2-[(4-nitrobenzoyl)amino]benzoyl]amino]pentanoate (PubChem CID 7220956) has the molecular formula C20H20N3O6- and a molecular weight of 398.40 g/mol. Its IUPAC name is (2R)-4-methyl-2-[[2-[(4-nitrobenzoyl)amino]benzoyl]amino]pentanoate.
| Compound Name | (2R)-4-methyl-2-[[2-[(4-nitrobenzoyl)amino]benzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 7220956 |
| Molecular Formula | C20H20N3O6- |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2R)-4-methyl-2-[[2-[(4-nitrobenzoyl)amino]benzoyl]amino]pentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)c1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)[O-] |
| InChI | InChI=1S/C20H21N3O6/c1-12(2)11-17(20(26)27)22-19(25)15-5-3-4-6-16(15)21-18(24)13-7-9-14(10-8-13)23(28)29/h3-10,12,17H,11H2,1-2H3,(H,21,24)(H,22,25)(H,26,27)/p-1/t17-/m1/s1 |
| InChIKey | OQWJFHMSUYBXOP-QGZVFWFLSA-M |
| XLogP | 1.74 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|