C15H9Cl2F3N2O3 — CID 2744744
2,4-dichloro-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide (PubChem CID 2744744) has the molecular formula C15H9Cl2F3N2O3 and a molecular weight of 393.15 g/mol. Its IUPAC name is 2,4-dichloro-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 2744744 |
| Molecular Formula | C15H9Cl2F3N2O3 |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2,4-dichloro-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1Cl)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H9Cl2F3N2O3/c16-9-3-6-11(12(17)7-9)14(24)22-21-13(23)8-1-4-10(5-2-8)25-15(18,19)20/h1-7H,(H,21,23)(H,22,24) |
| InChIKey | YJLGJENRFAVPQF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|