C20H19Cl2F3N2O3 — CID 19752817
N'-tert-butyl-2,4-dichloro-N-methyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide (PubChem CID 19752817) has the molecular formula C20H19Cl2F3N2O3 and a molecular weight of 463.28 g/mol. Its IUPAC name is N'-tert-butyl-2,4-dichloro-N-methyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide.
| Compound Name | N'-tert-butyl-2,4-dichloro-N-methyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 19752817 |
| Molecular Formula | C20H19Cl2F3N2O3 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N'-tert-butyl-2,4-dichloro-N-methyl-N'-[4-(trifluoromethoxy)benzoyl]benzohydrazide |
| SMILES | CN(C(=O)c1ccc(Cl)cc1Cl)N(C(=O)c1ccc(OC(F)(F)F)cc1)C(C)(C)C |
| InChI | InChI=1S/C20H19Cl2F3N2O3/c1-19(2,3)27(26(4)18(29)15-10-7-13(21)11-16(15)22)17(28)12-5-8-14(9-6-12)30-20(23,24)25/h5-11H,1-4H3 |
| InChIKey | HYRVRKGUGUOVOF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|