C19H20Cl2N2O2 — CID 19752979
N'-benzoyl-N-tert-butyl-3,5-dichloro-N'-methylbenzohydrazide (PubChem CID 19752979) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N'-benzoyl-N-tert-butyl-3,5-dichloro-N'-methylbenzohydrazide.
| Compound Name | N'-benzoyl-N-tert-butyl-3,5-dichloro-N'-methylbenzohydrazide |
|---|---|
| PubChem CID | 19752979 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N'-benzoyl-N-tert-butyl-3,5-dichloro-N'-methylbenzohydrazide |
| SMILES | CN(C(=O)c1ccccc1)N(C(=O)c1cc(Cl)cc(Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-19(2,3)23(18(25)14-10-15(20)12-16(21)11-14)22(4)17(24)13-8-6-5-7-9-13/h5-12H,1-4H3 |
| InChIKey | JSVJLRXJEHSDOP-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|