C13H18Cl2N2O — CID 79653062
N-(3-amino-2,2-dimethylpropyl)-3,5-dichloro-N-methylbenzamide (PubChem CID 79653062) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3,5-dichloro-N-methylbenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3,5-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 79653062 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3,5-dichloro-N-methylbenzamide |
| SMILES | CN(CC(C)(C)CN)C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H18Cl2N2O/c1-13(2,7-16)8-17(3)12(18)9-4-10(14)6-11(15)5-9/h4-6H,7-8,16H2,1-3H3 |
| InChIKey | VSXWOUCJQHRCEX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |