C13H18ClNO2 — CID 81002742
3-chloro-N-(2-hydroxy-2-methylpropyl)-N,5-dimethylbenzamide (PubChem CID 81002742) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,5-dimethylbenzamide.
| Compound Name | 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 81002742 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 3-chloro-N-(2-hydroxy-2-methylpropyl)-N,5-dimethylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)N(C)CC(C)(C)O)c1 |
| InChI | InChI=1S/C13H18ClNO2/c1-9-5-10(7-11(14)6-9)12(16)15(4)8-13(2,3)17/h5-7,17H,8H2,1-4H3 |
| InChIKey | BJYSQFQNQHMOLP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |