C12H16F2N2O2 — CID 79385577
4-amino-3,5-difluoro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzamide (PubChem CID 79385577) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-amino-3,5-difluoro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzamide.
| Compound Name | 4-amino-3,5-difluoro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 79385577 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-amino-3,5-difluoro-N-(2-hydroxy-2-methylpropyl)-N-methylbenzamide |
| SMILES | CN(CC(C)(C)O)C(=O)c1cc(F)c(N)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O2/c1-12(2,18)6-16(3)11(17)7-4-8(13)10(15)9(14)5-7/h4-5,18H,6,15H2,1-3H3 |
| InChIKey | UEWCYJZZNNHZNX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|