C13H19ClN2O3S — CID 65389265
3-chloro-N-(2,2-dimethylpropyl)-N-methyl-5-sulfamoylbenzamide (PubChem CID 65389265) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethylpropyl)-N-methyl-5-sulfamoylbenzamide.
| Compound Name | 3-chloro-N-(2,2-dimethylpropyl)-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65389265 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-chloro-N-(2,2-dimethylpropyl)-N-methyl-5-sulfamoylbenzamide |
| SMILES | CN(CC(C)(C)C)C(=O)c1cc(Cl)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H19ClN2O3S/c1-13(2,3)8-16(4)12(17)9-5-10(14)7-11(6-9)20(15,18)19/h5-7H,8H2,1-4H3,(H2,15,18,19) |
| InChIKey | JZQVSCPBYWJTPS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |