C10H13FN2O3S — CID 65375225
N-ethyl-3-fluoro-N-methyl-5-sulfamoylbenzamide (PubChem CID 65375225) has the molecular formula C10H13FN2O3S and a molecular weight of 260.29 g/mol. Its IUPAC name is N-ethyl-3-fluoro-N-methyl-5-sulfamoylbenzamide.
| Compound Name | N-ethyl-3-fluoro-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375225 |
| Molecular Formula | C10H13FN2O3S |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-ethyl-3-fluoro-N-methyl-5-sulfamoylbenzamide |
| SMILES | CCN(C)C(=O)c1cc(F)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H13FN2O3S/c1-3-13(2)10(14)7-4-8(11)6-9(5-7)17(12,15)16/h4-6H,3H2,1-2H3,(H2,12,15,16) |
| InChIKey | FHCRRNFHZAGNSD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |